C17H28N4 — CID 60976012
N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]octan-2-amine (PubChem CID 60976012) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]octan-2-amine.
| Compound Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]octan-2-amine |
|---|---|
| PubChem CID | 60976012 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]octan-2-amine |
| SMILES | CCCCCCC(C)NCc1cnc2c(c1)c(C)nn2C |
| InChI | InChI=1S/C17H28N4/c1-5-6-7-8-9-13(2)18-11-15-10-16-14(3)20-21(4)17(16)19-12-15/h10,12-13,18H,5-9,11H2,1-4H3 |
| InChIKey | NSGGIDANJQMIKO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|