C16H21N3O — CID 60977019
2-[(2-cyclopentylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 60977019) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(2-cyclopentylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(2-cyclopentylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 60977019 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(2-cyclopentylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCC2CCCC2)nc2ccccn12 |
| InChI | InChI=1S/C16H21N3O/c20-16-11-14(18-15-7-3-4-10-19(15)16)12-17-9-8-13-5-1-2-6-13/h3-4,7,10-11,13,17H,1-2,5-6,8-9,12H2 |
| InChIKey | IMYMHPZBVWBZOG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|