C11H22N4 — CID 60978338
5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)heptan-3-amine (PubChem CID 60978338) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)heptan-3-amine.
| Compound Name | 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)heptan-3-amine |
|---|---|
| PubChem CID | 60978338 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)heptan-3-amine |
| SMILES | CCC(C)CC(CC)NCc1ncn[nH]1 |
| InChI | InChI=1S/C11H22N4/c1-4-9(3)6-10(5-2)12-7-11-13-8-14-15-11/h8-10,12H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | WYVJPEFMULABSX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |