C10H13N5 — CID 60978592
1-pyridin-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine (PubChem CID 60978592) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine.
| Compound Name | 1-pyridin-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 60978592 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-pyridin-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine |
| SMILES | CC(NCc1ncn[nH]1)c1ccccn1 |
| InChI | InChI=1S/C10H13N5/c1-8(9-4-2-3-5-11-9)12-6-10-13-7-14-15-10/h2-5,7-8,12H,6H2,1H3,(H,13,14,15) |
| InChIKey | CUGJDXXWCXWWCS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |