C14H20N4O3 — CID 60979497
6-(3-pyrrolidin-2-ylpiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 60979497) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 6-(3-pyrrolidin-2-ylpiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-pyrrolidin-2-ylpiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60979497 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-(3-pyrrolidin-2-ylpiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCCC(C2CCCN2)C1 |
| InChI | InChI=1S/C14H20N4O3/c19-12-7-11(16-14(21)17-12)13(20)18-6-2-3-9(8-18)10-4-1-5-15-10/h7,9-10,15H,1-6,8H2,(H2,16,17,19,21) |
| InChIKey | POWXWJAEIDSOMV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |