C15H22N2O3 — CID 60980183
1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,4-diazepan-1-yl)ethanol (PubChem CID 60980183) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,4-diazepan-1-yl)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,4-diazepan-1-yl)ethanol |
|---|---|
| PubChem CID | 60980183 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,4-diazepan-1-yl)ethanol |
| SMILES | CN1CCCN(CC(O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H22N2O3/c1-16-5-2-6-17(8-7-16)10-13(18)12-3-4-14-15(9-12)20-11-19-14/h3-4,9,13,18H,2,5-8,10-11H2,1H3 |
| InChIKey | UDSNILKNIGBRPA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |