C11H16FNO2 — CID 60981186
2-[N-ethyl-2-fluoro-4-(hydroxymethyl)anilino]ethanol (PubChem CID 60981186) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 2-[N-ethyl-2-fluoro-4-(hydroxymethyl)anilino]ethanol.
| Compound Name | 2-[N-ethyl-2-fluoro-4-(hydroxymethyl)anilino]ethanol |
|---|---|
| PubChem CID | 60981186 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-[N-ethyl-2-fluoro-4-(hydroxymethyl)anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(CO)cc1F |
| InChI | InChI=1S/C11H16FNO2/c1-2-13(5-6-14)11-4-3-9(8-15)7-10(11)12/h3-4,7,14-15H,2,5-6,8H2,1H3 |
| InChIKey | HCDFGGBITFPOGB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|