C8H13N5O2S — CID 60982198
3-(2-amino-2-oxoethyl)sulfanyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide (PubChem CID 60982198) has the molecular formula C8H13N5O2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 60982198 |
| Molecular Formula | C8H13N5O2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
| SMILES | NC(=O)CSCCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C8H13N5O2S/c9-6(14)4-16-2-1-8(15)10-3-7-11-5-12-13-7/h5H,1-4H2,(H2,9,14)(H,10,15)(H,11,12,13) |
| InChIKey | CGLGCUNWCBIXHH-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|