C9H10N4O2 — CID 60982681
5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)furan-2-carboxamide (PubChem CID 60982681) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60982681 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCc2ncn[nH]2)o1 |
| InChI | InChI=1S/C9H10N4O2/c1-6-2-3-7(15-6)9(14)10-4-8-11-5-12-13-8/h2-3,5H,4H2,1H3,(H,10,14)(H,11,12,13) |
| InChIKey | COLNYZKQSLTLEE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |