C13H17ClN2 — CID 60987308
2-(4-chloroanilino)-2,4-dimethylpentanenitrile (PubChem CID 60987308) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2,4-dimethylpentanenitrile.
| Compound Name | 2-(4-chloroanilino)-2,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 60987308 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(4-chloroanilino)-2,4-dimethylpentanenitrile |
| SMILES | CC(C)CC(C)(C#N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2/c1-10(2)8-13(3,9-15)16-12-6-4-11(14)5-7-12/h4-7,10,16H,8H2,1-3H3 |
| InChIKey | VRCXCEVDYVTTBI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |