About 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid
3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid (PubChem CID 60987332) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid.
Analyze 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid?
The IUPAC name of 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid (CID 60987332) is 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid.
What is the SMILES notation for 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid?
The canonical SMILES for 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid is CN(CCC(=O)O)Cc1ncon1.
What is the InChIKey of 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid?
The InChIKey is OEBXCFOKGGJSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-10(3-2-7(11)12)4-6-8-5-13-9-6/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid?
3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid has a molecular weight of 185.18 g/mol, XLogP of -0.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(1,2,4-oxadiazol-3-ylmethyl)amino]propanoic acid is sourced from PubChem (CID 60987332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).