C15H22F2N2O2 — CID 60993361
2-[2-(diethylamino)ethylamino]-2-(2,4-difluorophenyl)propanoic acid (PubChem CID 60993361) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-2-(2,4-difluorophenyl)propanoic acid.
| Compound Name | 2-[2-(diethylamino)ethylamino]-2-(2,4-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 60993361 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-2-(2,4-difluorophenyl)propanoic acid |
| SMILES | CCN(CC)CCNC(C)(C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H22F2N2O2/c1-4-19(5-2)9-8-18-15(3,14(20)21)12-7-6-11(16)10-13(12)17/h6-7,10,18H,4-5,8-9H2,1-3H3,(H,20,21) |
| InChIKey | SMGYMUUGMUSIBZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |