C13H15BrN2 — CID 61002469
2-(2-bromophenyl)-2-(cyclopentylamino)acetonitrile (PubChem CID 61002469) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-(cyclopentylamino)acetonitrile.
| Compound Name | 2-(2-bromophenyl)-2-(cyclopentylamino)acetonitrile |
|---|---|
| PubChem CID | 61002469 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(2-bromophenyl)-2-(cyclopentylamino)acetonitrile |
| SMILES | N#CC(NC1CCCC1)c1ccccc1Br |
| InChI | InChI=1S/C13H15BrN2/c14-12-8-4-3-7-11(12)13(9-15)16-10-5-1-2-6-10/h3-4,7-8,10,13,16H,1-2,5-6H2 |
| InChIKey | ORQRKDNJPMFIHL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |