C14H20BrFN2O2 — CID 61002636
ethyl 2-(4-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetate (PubChem CID 61002636) has the molecular formula C14H20BrFN2O2 and a molecular weight of 347.23 g/mol. Its IUPAC name is ethyl 2-(4-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetate.
| Compound Name | ethyl 2-(4-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetate |
|---|---|
| PubChem CID | 61002636 |
| Molecular Formula | C14H20BrFN2O2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | ethyl 2-(4-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetate |
| SMILES | CCOC(=O)C(NCCN(C)C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H20BrFN2O2/c1-4-20-14(19)13(17-7-8-18(2)3)11-6-5-10(15)9-12(11)16/h5-6,9,13,17H,4,7-8H2,1-3H3 |
| InChIKey | SPBADXUYDCEWIT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |