C16H25N3O — CID 61005096
2-[2-(diethylamino)ethylamino]-1,3-dihydroindene-2-carboxamide (PubChem CID 61005096) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 61005096 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-1,3-dihydroindene-2-carboxamide |
| SMILES | CCN(CC)CCNC1(C(N)=O)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H25N3O/c1-3-19(4-2)10-9-18-16(15(17)20)11-13-7-5-6-8-14(13)12-16/h5-8,18H,3-4,9-12H2,1-2H3,(H2,17,20) |
| InChIKey | SJIDXKYCLIWLLX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |