C14H20N2 — CID 61006364
2-(benzylamino)-2,3-dimethylpentanenitrile (PubChem CID 61006364) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(benzylamino)-2,3-dimethylpentanenitrile.
| Compound Name | 2-(benzylamino)-2,3-dimethylpentanenitrile |
|---|---|
| PubChem CID | 61006364 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(benzylamino)-2,3-dimethylpentanenitrile |
| SMILES | CCC(C)C(C)(C#N)NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-4-12(2)14(3,11-15)16-10-13-8-6-5-7-9-13/h5-9,12,16H,4,10H2,1-3H3 |
| InChIKey | IBKYRFDPAIINFL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |