C14H20N2O — CID 54887592
2-(2-methoxyanilino)-2,3-dimethylpentanenitrile (PubChem CID 54887592) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-2,3-dimethylpentanenitrile.
| Compound Name | 2-(2-methoxyanilino)-2,3-dimethylpentanenitrile |
|---|---|
| PubChem CID | 54887592 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-(2-methoxyanilino)-2,3-dimethylpentanenitrile |
| SMILES | CCC(C)C(C)(C#N)Nc1ccccc1OC |
| InChI | InChI=1S/C14H20N2O/c1-5-11(2)14(3,10-15)16-12-8-6-7-9-13(12)17-4/h6-9,11,16H,5H2,1-4H3 |
| InChIKey | KCSZYDDGCBOBKP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |