C12H15BrN2O2 — CID 66167820
2-(2-bromoanilino)-3,3-dimethoxy-2-methylpropanenitrile (PubChem CID 66167820) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 2-(2-bromoanilino)-3,3-dimethoxy-2-methylpropanenitrile.
| Compound Name | 2-(2-bromoanilino)-3,3-dimethoxy-2-methylpropanenitrile |
|---|---|
| PubChem CID | 66167820 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(2-bromoanilino)-3,3-dimethoxy-2-methylpropanenitrile |
| SMILES | COC(OC)C(C)(C#N)Nc1ccccc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-12(8-14,11(16-2)17-3)15-10-7-5-4-6-9(10)13/h4-7,11,15H,1-3H3 |
| InChIKey | VPNGLUYOEJFRBX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|