C14H22N2O4S — CID 61010538
methyl 2-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-2-yl]acetate (PubChem CID 61010538) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is methyl 2-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 61010538 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methyl 2-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1C(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C14H22N2O4S/c1-20-13(18)10-11-4-2-3-6-16(11)12(17)5-7-15-8-9-21-14(15)19/h11H,2-10H2,1H3 |
| InChIKey | SDGLKGJNCDJENH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|