C14H19NO5 — CID 61011460
2-[[2-(4-ethoxyphenoxy)-2-oxoethyl]-ethylamino]acetic acid (PubChem CID 61011460) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[[2-(4-ethoxyphenoxy)-2-oxoethyl]-ethylamino]acetic acid.
| Compound Name | 2-[[2-(4-ethoxyphenoxy)-2-oxoethyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 61011460 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-[[2-(4-ethoxyphenoxy)-2-oxoethyl]-ethylamino]acetic acid |
| SMILES | CCOc1ccc(OC(=O)CN(CC)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO5/c1-3-15(9-13(16)17)10-14(18)20-12-7-5-11(6-8-12)19-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,17) |
| InChIKey | VTLPWPOKJUKOIH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|