About [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate
[4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate (PubChem CID 68807016) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate |
| PubChem CID | 68807016 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)Oc1ccc(OC(=O)CN(C)C)cc1 |
| InChI | InChI=1S/C14H20N2O4/c1-15(2)9-13(17)19-11-5-7-12(8-6-11)20-14(18)10-16(3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | GBIUXRMAKAAYMS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate?
The IUPAC name of [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate (CID 68807016) is [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate.
What is the SMILES notation for [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate?
The canonical SMILES for [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate is CN(C)CC(=O)Oc1ccc(OC(=O)CN(C)C)cc1.
What is the InChIKey of [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate?
The InChIKey is GBIUXRMAKAAYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-15(2)9-13(17)19-11-5-7-12(8-6-11)20-14(18)10-16(3)4/h5-8H,9-10H2,1-4H3.
What are the key properties of [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate?
[4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate has a molecular weight of 280.32 g/mol, XLogP of 0.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(dimethylamino)acetyl]oxyphenyl] 2-(dimethylamino)acetate is sourced from PubChem (CID 68807016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).