About (3-propan-2-ylphenyl) 2-(dimethylamino)acetate
(3-propan-2-ylphenyl) 2-(dimethylamino)acetate (PubChem CID 91261500) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (3-propan-2-ylphenyl) 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | (3-propan-2-ylphenyl) 2-(dimethylamino)acetate |
| PubChem CID | 91261500 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3-propan-2-ylphenyl) 2-(dimethylamino)acetate |
| SMILES | CC(C)c1cccc(OC(=O)CN(C)C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-10(2)11-6-5-7-12(8-11)16-13(15)9-14(3)4/h5-8,10H,9H2,1-4H3 |
| InChIKey | DMGPNMWLSFGKFC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-propan-2-ylphenyl) 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-ylphenyl) 2-(dimethylamino)acetate?
The IUPAC name of (3-propan-2-ylphenyl) 2-(dimethylamino)acetate (CID 91261500) is (3-propan-2-ylphenyl) 2-(dimethylamino)acetate.
What is the SMILES notation for (3-propan-2-ylphenyl) 2-(dimethylamino)acetate?
The canonical SMILES for (3-propan-2-ylphenyl) 2-(dimethylamino)acetate is CC(C)c1cccc(OC(=O)CN(C)C)c1.
What is the InChIKey of (3-propan-2-ylphenyl) 2-(dimethylamino)acetate?
The InChIKey is DMGPNMWLSFGKFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-10(2)11-6-5-7-12(8-11)16-13(15)9-14(3)4/h5-8,10H,9H2,1-4H3.
What are the key properties of (3-propan-2-ylphenyl) 2-(dimethylamino)acetate?
(3-propan-2-ylphenyl) 2-(dimethylamino)acetate has a molecular weight of 221.30 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-ylphenyl) 2-(dimethylamino)acetate is sourced from PubChem (CID 91261500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).