About (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate
(3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate (PubChem CID 88617985) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate.
Molecular Properties
| Compound Name | (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate |
| PubChem CID | 88617985 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate |
| SMILES | CC(C)c1cccc(OC(=O)N(C)SN2CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12(2)13-5-4-6-14(11-13)20-15(18)16(3)21-17-7-9-19-10-8-17/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | CRNXRUZXVPNMGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate?
The IUPAC name of (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate (CID 88617985) is (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate.
What is the SMILES notation for (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate?
The canonical SMILES for (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate is CC(C)c1cccc(OC(=O)N(C)SN2CCOCC2)c1.
What is the InChIKey of (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate?
The InChIKey is CRNXRUZXVPNMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-12(2)13-5-4-6-14(11-13)20-15(18)16(3)21-17-7-9-19-10-8-17/h4-6,11-12H,7-10H2,1-3H3.
What are the key properties of (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate?
(3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate has a molecular weight of 310.42 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-ylphenyl) N-methyl-N-morpholin-4-ylsulfanylcarbamate is sourced from PubChem (CID 88617985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).