About (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate
(4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate (PubChem CID 89459514) has the molecular formula C9H14N4O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate.
Analyze (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate?
The IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate (CID 89459514) is (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate.
What is the SMILES notation for (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate?
The canonical SMILES for (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate is COc1nc(OC)nc(OC(=O)CN(C)C)n1.
What is the InChIKey of (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate?
The InChIKey is ZXLLQBDNPKDRJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O4/c1-13(2)5-6(14)17-9-11-7(15-3)10-8(12-9)16-4/h5H2,1-4H3.
What are the key properties of (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate?
(4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate has a molecular weight of 242.23 g/mol, XLogP of -0.64, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethoxy-1,3,5-triazin-2-yl) 2-(dimethylamino)acetate is sourced from PubChem (CID 89459514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).