C14H20Cl2N4O — CID 61017271
2-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]-1-piperazin-1-ylethanone (PubChem CID 61017271) has the molecular formula C14H20Cl2N4O and a molecular weight of 331.25 g/mol. Its IUPAC name is 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 61017271 |
| Molecular Formula | C14H20Cl2N4O |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]-1-piperazin-1-ylethanone |
| SMILES | Cc1cc(Cl)c(CN(C)CC(=O)N2CCNCC2)c(Cl)n1 |
| InChI | InChI=1S/C14H20Cl2N4O/c1-10-7-12(15)11(14(16)18-10)8-19(2)9-13(21)20-5-3-17-4-6-20/h7,17H,3-6,8-9H2,1-2H3 |
| InChIKey | KNLOJFMWSKDVFS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|