C11H17N5O4S — CID 61018102
2-[4-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 61018102) has the molecular formula C11H17N5O4S and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-[4-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61018102 |
| Molecular Formula | C11H17N5O4S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[4-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)Nc1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C11H17N5O4S/c1-21-3-2-8(15-11(12)20)10(19)14-7-4-13-16(5-7)6-9(17)18/h4-5,8H,2-3,6H2,1H3,(H,14,19)(H,17,18)(H3,12,15,20) |
| InChIKey | OWKGZIYWWZVHET-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |