C16H26N4O3S — CID 124670488
(2R)-2-acetamido-4-methylsulfanyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide (PubChem CID 124670488) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is (2R)-2-acetamido-4-methylsulfanyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide.
| Compound Name | (2R)-2-acetamido-4-methylsulfanyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 124670488 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R)-2-acetamido-4-methylsulfanyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]butanamide |
| SMILES | CSCC[C@@H](NC(C)=O)C(=O)Nc1cnn(CC2CCOCC2)c1 |
| InChI | InChI=1S/C16H26N4O3S/c1-12(21)18-15(5-8-24-2)16(22)19-14-9-17-20(11-14)10-13-3-6-23-7-4-13/h9,11,13,15H,3-8,10H2,1-2H3,(H,18,21)(H,19,22)/t15-/m1/s1 |
| InChIKey | JHGOIPGHSCYPSI-OAHLLOKOSA-N |
| XLogP | 1.51 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |