C18H24N4O4 — CID 90622367
1-(3,5-dimethoxyphenyl)-3-[1-(oxan-4-ylmethyl)pyrazol-4-yl]urea (PubChem CID 90622367) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[1-(oxan-4-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[1-(oxan-4-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 90622367 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[1-(oxan-4-ylmethyl)pyrazol-4-yl]urea |
| SMILES | COc1cc(NC(=O)Nc2cnn(CC3CCOCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H24N4O4/c1-24-16-7-14(8-17(9-16)25-2)20-18(23)21-15-10-19-22(12-15)11-13-3-5-26-6-4-13/h7-10,12-13H,3-6,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | MQFAZQRUQPIRAX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |