C13H13N3O5 — CID 61018494
2-[4-[[2-(2-hydroxyphenoxy)acetyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 61018494) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[4-[[2-(2-hydroxyphenoxy)acetyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-(2-hydroxyphenoxy)acetyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61018494 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[4-[[2-(2-hydroxyphenoxy)acetyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)COc2ccccc2O)cn1 |
| InChI | InChI=1S/C13H13N3O5/c17-10-3-1-2-4-11(10)21-8-12(18)15-9-5-14-16(6-9)7-13(19)20/h1-6,17H,7-8H2,(H,15,18)(H,19,20) |
| InChIKey | XZYIATCIZFVPPP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |