C14H23N3O2S — CID 61019869
2-methyl-N-[(5-nitrothiophen-3-yl)methyl]-3-piperidin-1-ylpropan-1-amine (PubChem CID 61019869) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-methyl-N-[(5-nitrothiophen-3-yl)methyl]-3-piperidin-1-ylpropan-1-amine.
| Compound Name | 2-methyl-N-[(5-nitrothiophen-3-yl)methyl]-3-piperidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 61019869 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-methyl-N-[(5-nitrothiophen-3-yl)methyl]-3-piperidin-1-ylpropan-1-amine |
| SMILES | CC(CNCc1csc([N+](=O)[O-])c1)CN1CCCCC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-12(10-16-5-3-2-4-6-16)8-15-9-13-7-14(17(18)19)20-11-13/h7,11-12,15H,2-6,8-10H2,1H3 |
| InChIKey | JQESNXNSWOHVNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|