C17H26N4 — CID 61020851
N-[(1-ethylbenzimidazol-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 61020851) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 61020851 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CCn1c(CNCCCN2CCCC2)nc2ccccc21 |
| InChI | InChI=1S/C17H26N4/c1-2-21-16-9-4-3-8-15(16)19-17(21)14-18-10-7-13-20-11-5-6-12-20/h3-4,8-9,18H,2,5-7,10-14H2,1H3 |
| InChIKey | KIOJAYGVCUMHTB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|