About dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel
dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel (PubChem CID 6102221) has the molecular formula C30H32Cl2NiP2
and a molecular weight of 584.13 g/mol. Its IUPAC name is dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel.
Molecular Properties
| Compound Name | dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel |
| PubChem CID | 6102221 |
| Molecular Formula | C30H32Cl2NiP2 |
| Molecular Weight | 584.13 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel |
| SMILES | Cl[Ni]Cl.c1ccc(CP(CCP(Cc2ccccc2)Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H32P2.2ClH.Ni/c1-5-13-27(14-6-1)23-31(24-28-15-7-2-8-16-28)21-22-32(25-29-17-9-3-10-18-29)26-30-19-11-4-12-20-30;;;/h1-20H,21-26H2;2*1H;/q;;;+2/p-2 |
| InChIKey | PVIOHKJRJYKSMC-UHFFFAOYSA-L |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.13 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel?
The IUPAC name of dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel (CID 6102221) is dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel.
What is the SMILES notation for dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel?
The canonical SMILES for dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel is Cl[Ni]Cl.c1ccc(CP(CCP(Cc2ccccc2)Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel?
The InChIKey is PVIOHKJRJYKSMC-UHFFFAOYSA-L. The full InChI is InChI=1S/C30H32P2.2ClH.Ni/c1-5-13-27(14-6-1)23-31(24-28-15-7-2-8-16-28)21-22-32(25-29-17-9-3-10-18-29)26-30-19-11-4-12-20-30;;;/h1-20H,21-26H2;2*1H;/q;;;+2/p-2.
What are the key properties of dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel?
dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel has a molecular weight of 584.13 g/mol, XLogP of 10.13, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl(2-dibenzylphosphanylethyl)phosphane;dichloronickel is sourced from PubChem (CID 6102221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).