C15H22Cl2N2O — CID 61022567
N-butan-2-yl-3-[1-(3,4-dichlorophenyl)ethylamino]propanamide (PubChem CID 61022567) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is N-butan-2-yl-3-[1-(3,4-dichlorophenyl)ethylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[1-(3,4-dichlorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 61022567 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-butan-2-yl-3-[1-(3,4-dichlorophenyl)ethylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-4-10(2)19-15(20)7-8-18-11(3)12-5-6-13(16)14(17)9-12/h5-6,9-11,18H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | KIPHKGZWXPKRBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |