C14H24N4O3 — CID 61022788
N-butan-2-yl-3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]propanamide (PubChem CID 61022788) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-butan-2-yl-3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 61022788 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-butan-2-yl-3-[(4,6-dimethoxypyrimidin-5-yl)methylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCc1c(OC)ncnc1OC |
| InChI | InChI=1S/C14H24N4O3/c1-5-10(2)18-12(19)6-7-15-8-11-13(20-3)16-9-17-14(11)21-4/h9-10,15H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | HSLMHEGFRGCQQQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|