C16H31NO2 — CID 61024663
1-(butan-2-ylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 61024663) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-(butan-2-ylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(butan-2-ylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61024663 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 1-(butan-2-ylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(C)NC1(C(=O)O)CCC(C(C)(C)CC)CC1 |
| InChI | InChI=1S/C16H31NO2/c1-6-12(3)17-16(14(18)19)10-8-13(9-11-16)15(4,5)7-2/h12-13,17H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | NAAJFUGZHMVJMV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |