C15H27NO2 — CID 43754485
1-(cyclopropylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 43754485) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(cyclopropylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(cyclopropylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 43754485 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-(cyclopropylamino)-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(C)(C)C1CCC(NC2CC2)(C(=O)O)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-4-14(2,3)11-7-9-15(10-8-11,13(17)18)16-12-5-6-12/h11-12,16H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | VMMVRGFQQARAEC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |