C17H33NO — CID 61054767
[1-(cyclopentylamino)-4-(2-methylbutan-2-yl)cyclohexyl]methanol (PubChem CID 61054767) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is [1-(cyclopentylamino)-4-(2-methylbutan-2-yl)cyclohexyl]methanol.
| Compound Name | [1-(cyclopentylamino)-4-(2-methylbutan-2-yl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 61054767 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | [1-(cyclopentylamino)-4-(2-methylbutan-2-yl)cyclohexyl]methanol |
| SMILES | CCC(C)(C)C1CCC(CO)(NC2CCCC2)CC1 |
| InChI | InChI=1S/C17H33NO/c1-4-16(2,3)14-9-11-17(13-19,12-10-14)18-15-7-5-6-8-15/h14-15,18-19H,4-13H2,1-3H3 |
| InChIKey | SPRFPGAPQSTENA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |