C16H15N3O2 — CID 61026773
2-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]aniline (PubChem CID 61026773) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]aniline.
| Compound Name | 2-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]aniline |
|---|---|
| PubChem CID | 61026773 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]aniline |
| SMILES | Cc1ccc(-c2nc(COc3ccccc3N)no2)cc1 |
| InChI | InChI=1S/C16H15N3O2/c1-11-6-8-12(9-7-11)16-18-15(19-21-16)10-20-14-5-3-2-4-13(14)17/h2-9H,10,17H2,1H3 |
| InChIKey | QUKFJYMCVOMNDW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|