C11H12O4 — CID 610343
methyl 3,5-dioxo-2,4,6,7-tetrahydro-1H-indene-2-carboxylate (PubChem CID 610343) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl 3,5-dioxo-2,4,6,7-tetrahydro-1H-indene-2-carboxylate.
| Compound Name | methyl 3,5-dioxo-2,4,6,7-tetrahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 610343 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl 3,5-dioxo-2,4,6,7-tetrahydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1CC2=C(CC(=O)CC2)C1=O |
| InChI | InChI=1S/C11H12O4/c1-15-11(14)9-4-6-2-3-7(12)5-8(6)10(9)13/h9H,2-5H2,1H3 |
| InChIKey | ZRSYUMTYWTZCHA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|