C14H20O3 — CID 164889856
methyl (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylate (PubChem CID 164889856) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 164889856 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C2=C(CCC2=O)C[C@H](C)[C@H]1C |
| InChI | InChI=1S/C14H20O3/c1-8-7-10-5-6-11(15)12(10)14(3,9(8)2)13(16)17-4/h8-9H,5-7H2,1-4H3/t8-,9+,14+/m0/s1 |
| InChIKey | AFOGMKWLZDQCBW-ATEUNZGCSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |