C13H11ClF2N2O2S — CID 61041711
2-chloro-N-[1-(2,6-difluorophenyl)ethyl]pyridine-3-sulfonamide (PubChem CID 61041711) has the molecular formula C13H11ClF2N2O2S and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,6-difluorophenyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[1-(2,6-difluorophenyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61041711 |
| Molecular Formula | C13H11ClF2N2O2S |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-chloro-N-[1-(2,6-difluorophenyl)ethyl]pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccnc1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C13H11ClF2N2O2S/c1-8(12-9(15)4-2-5-10(12)16)18-21(19,20)11-6-3-7-17-13(11)14/h2-8,18H,1H3 |
| InChIKey | WPRNABDLJFVGAN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|