C10H14ClF3N2O3S2 — CID 61047432
2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 61047432) has the molecular formula C10H14ClF3N2O3S2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61047432 |
| Molecular Formula | C10H14ClF3N2O3S2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | CCOCCCN(CC(F)(F)F)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H14ClF3N2O3S2/c1-2-19-5-3-4-16(7-10(12,13)14)21(17,18)8-6-15-9(11)20-8/h6H,2-5,7H2,1H3 |
| InChIKey | UPDLAHPDWPCZPZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|