C17H20FNO — CID 61047714
2-(3,4-dimethylphenyl)-2-(3-fluoroanilino)propan-1-ol (PubChem CID 61047714) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-2-(3-fluoroanilino)propan-1-ol.
| Compound Name | 2-(3,4-dimethylphenyl)-2-(3-fluoroanilino)propan-1-ol |
|---|---|
| PubChem CID | 61047714 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-2-(3-fluoroanilino)propan-1-ol |
| SMILES | Cc1ccc(C(C)(CO)Nc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C17H20FNO/c1-12-7-8-14(9-13(12)2)17(3,11-20)19-16-6-4-5-15(18)10-16/h4-10,19-20H,11H2,1-3H3 |
| InChIKey | PIDRTXDJNCMWGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |