C15H21F3N2O — CID 61048628
2-(1,4-diazepan-1-yl)-2-[4-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 61048628) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-[4-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-[4-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 61048628 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-[4-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC(CO)(c1ccc(C(F)(F)F)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C15H21F3N2O/c1-14(11-21,20-9-2-7-19-8-10-20)12-3-5-13(6-4-12)15(16,17)18/h3-6,19,21H,2,7-11H2,1H3 |
| InChIKey | BACLFIPKJXZMNT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |