C15H24N2OS — CID 61048838
2-(1,4-diazepan-1-yl)-2-(4-methylsulfanylphenyl)propan-1-ol (PubChem CID 61048838) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(4-methylsulfanylphenyl)propan-1-ol.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(4-methylsulfanylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 61048838 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(4-methylsulfanylphenyl)propan-1-ol |
| SMILES | CSc1ccc(C(C)(CO)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C15H24N2OS/c1-15(12-18,17-10-3-8-16-9-11-17)13-4-6-14(19-2)7-5-13/h4-7,16,18H,3,8-12H2,1-2H3 |
| InChIKey | WWTBNOFKHNYYNY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |