C13H12FNO4S2 — CID 61053183
ethyl 2-[(2-fluorophenyl)sulfonylamino]thiophene-3-carboxylate (PubChem CID 61053183) has the molecular formula C13H12FNO4S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is ethyl 2-[(2-fluorophenyl)sulfonylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-fluorophenyl)sulfonylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 61053183 |
| Molecular Formula | C13H12FNO4S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | ethyl 2-[(2-fluorophenyl)sulfonylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C13H12FNO4S2/c1-2-19-13(16)9-7-8-20-12(9)15-21(17,18)11-6-4-3-5-10(11)14/h3-8,15H,2H2,1H3 |
| InChIKey | CNNYGNMVCQSCPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |