C17H17NO3 — CID 61056907
2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 61056907) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 61056907 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)Cc2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C17H17NO3/c1-11-8-12(2)17(13(3)9-11)16(19)10-14-4-6-15(7-5-14)18(20)21/h4-9H,10H2,1-3H3 |
| InChIKey | JXPGKUDRTZTESR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|