C10H18ClNO3S — CID 61058012
5-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pentanamide (PubChem CID 61058012) has the molecular formula C10H18ClNO3S and a molecular weight of 267.78 g/mol. Its IUPAC name is 5-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pentanamide.
| Compound Name | 5-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 61058012 |
| Molecular Formula | C10H18ClNO3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]pentanamide |
| SMILES | O=C(CCCCCl)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18ClNO3S/c11-5-2-1-3-10(13)12-7-9-4-6-16(14,15)8-9/h9H,1-8H2,(H,12,13) |
| InChIKey | VMMDNSHZGQMKEX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|