C9H4Br3N3O3S — CID 61059590
2-(4-bromo-3-nitropyrazol-1-yl)-1-(2,5-dibromothiophen-3-yl)ethanone (PubChem CID 61059590) has the molecular formula C9H4Br3N3O3S and a molecular weight of 473.93 g/mol. Its IUPAC name is 2-(4-bromo-3-nitropyrazol-1-yl)-1-(2,5-dibromothiophen-3-yl)ethanone.
| Compound Name | 2-(4-bromo-3-nitropyrazol-1-yl)-1-(2,5-dibromothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 61059590 |
| Molecular Formula | C9H4Br3N3O3S |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 470.75 |
| IUPAC Name | 2-(4-bromo-3-nitropyrazol-1-yl)-1-(2,5-dibromothiophen-3-yl)ethanone |
| SMILES | O=C(Cn1cc(Br)c([N+](=O)[O-])n1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H4Br3N3O3S/c10-5-2-14(13-9(5)15(17)18)3-6(16)4-1-7(11)19-8(4)12/h1-2H,3H2 |
| InChIKey | NNYFRLGNHUJLBU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|