C9H5Br2N3O3S — CID 60733089
1-(2,5-dibromothiophen-3-yl)-2-(4-nitropyrazol-1-yl)ethanone (PubChem CID 60733089) has the molecular formula C9H5Br2N3O3S and a molecular weight of 395.03 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(4-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(4-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 60733089 |
| Molecular Formula | C9H5Br2N3O3S |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 392.84 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(4-nitropyrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H5Br2N3O3S/c10-8-1-6(9(11)18-8)7(15)4-13-3-5(2-12-13)14(16)17/h1-3H,4H2 |
| InChIKey | RKDYINVLAFXWLZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|